About ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate
ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate (PubChem CID 134493529) has the molecular formula C16H17F6N3O2S
and a molecular weight of 429.39 g/mol. Its IUPAC name is ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate |
| PubChem CID | 134493529 |
| Molecular Formula | C16H17F6N3O2S |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2cccc(S(F)(F)(F)(F)F)c2)c(F)c1N |
| InChI | InChI=1S/C16H17F6N3O2S/c1-2-27-16(26)25-13-7-6-12(14(17)15(13)23)24-9-10-4-3-5-11(8-10)28(18,19,20,21)22/h3-8,24H,2,9,23H2,1H3,(H,25,26) |
| InChIKey | AKYJGYNEPMATGG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate?
The IUPAC name of ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate (CID 134493529) is ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate.
What is the SMILES notation for ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate?
The canonical SMILES for ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate is CCOC(=O)Nc1ccc(NCc2cccc(S(F)(F)(F)(F)F)c2)c(F)c1N.
What is the InChIKey of ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate?
The InChIKey is AKYJGYNEPMATGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F6N3O2S/c1-2-27-16(26)25-13-7-6-12(14(17)15(13)23)24-9-10-4-3-5-11(8-10)28(18,19,20,21)22/h3-8,24H,2,9,23H2,1H3,(H,25,26).
What are the key properties of ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate?
ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate has a molecular weight of 429.39 g/mol, XLogP of 6.25, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-amino-3-fluoro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate is sourced from PubChem (CID 134493529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).