C16H15F6N5O — CID 134493676
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(2-cyclopropylhydrazinyl)prop-2-en-1-ol (PubChem CID 134493676) has the molecular formula C16H15F6N5O and a molecular weight of 407.32 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(2-cyclopropylhydrazinyl)prop-2-en-1-ol.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(2-cyclopropylhydrazinyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 134493676 |
| Molecular Formula | C16H15F6N5O |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(2-cyclopropylhydrazinyl)prop-2-en-1-ol |
| SMILES | OC(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)NNC1CC1 |
| InChI | InChI=1S/C16H15F6N5O/c17-15(18,19)10-5-9(6-11(7-10)16(20,21)22)14-23-8-27(26-14)4-3-13(28)25-24-12-1-2-12/h3-8,12-13,24-25,28H,1-2H2/b4-3- |
| InChIKey | PEBRWFXROVETSE-ARJAWSKDSA-N |
| XLogP | 3.03 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|