About 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one
6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 134493909) has the molecular formula C18H11ClFN3O2S
and a molecular weight of 387.82 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 134493909 |
| Molecular Formula | C18H11ClFN3O2S |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | O=C(Cn1c(=O)[nH]c2ncc(-c3ccc(F)c(Cl)c3)cc21)c1cccs1 |
| InChI | InChI=1S/C18H11ClFN3O2S/c19-12-6-10(3-4-13(12)20)11-7-14-17(21-8-11)22-18(25)23(14)9-15(24)16-2-1-5-26-16/h1-8H,9H2,(H,21,22,25) |
| InChIKey | AIGPRXBLOOQCFJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one (CID 134493909) is 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one is O=C(Cn1c(=O)[nH]c2ncc(-c3ccc(F)c(Cl)c3)cc21)c1cccs1.
What is the InChIKey of 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is AIGPRXBLOOQCFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClFN3O2S/c19-12-6-10(3-4-13(12)20)11-7-14-17(21-8-11)22-18(25)23(14)9-15(24)16-2-1-5-26-16/h1-8H,9H2,(H,21,22,25).
What are the key properties of 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one?
6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 387.82 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloro-4-fluorophenyl)-1-(2-oxo-2-thiophen-2-ylethyl)-3H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 134493909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).