C19H13F3N4O — CID 134493918
1-[(4-methyl-3-pyridinyl)methyl]-6-(3,4,5-trifluorophenyl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 134493918) has the molecular formula C19H13F3N4O and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[(4-methyl-3-pyridinyl)methyl]-6-(3,4,5-trifluorophenyl)-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-[(4-methyl-3-pyridinyl)methyl]-6-(3,4,5-trifluorophenyl)-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 134493918 |
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[(4-methyl-3-pyridinyl)methyl]-6-(3,4,5-trifluorophenyl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1ccncc1Cn1c(=O)[nH]c2ncc(-c3cc(F)c(F)c(F)c3)cc21 |
| InChI | InChI=1S/C19H13F3N4O/c1-10-2-3-23-7-13(10)9-26-16-6-12(8-24-18(16)25-19(26)27)11-4-14(20)17(22)15(21)5-11/h2-8H,9H2,1H3,(H,24,25,27) |
| InChIKey | YMBVXISLWUJQMX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|