C13H17N3O4 — CID 134494744
(2S)-4-(3,5-dimethyl-2-pyridinyl)piperazine-1,2-dicarboxylic acid (PubChem CID 134494744) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2S)-4-(3,5-dimethyl-2-pyridinyl)piperazine-1,2-dicarboxylic acid.
| Compound Name | (2S)-4-(3,5-dimethyl-2-pyridinyl)piperazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 134494744 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2S)-4-(3,5-dimethyl-2-pyridinyl)piperazine-1,2-dicarboxylic acid |
| SMILES | Cc1cnc(N2CCN(C(=O)O)[C@H](C(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C13H17N3O4/c1-8-5-9(2)11(14-6-8)15-3-4-16(13(19)20)10(7-15)12(17)18/h5-6,10H,3-4,7H2,1-2H3,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | SFMDYBAMNJVVGW-JTQLQIEISA-N |
| XLogP | 0.95 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |