About 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid
4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid (PubChem CID 134494746) has the molecular formula C12H9F3N2O4
and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid |
| PubChem CID | 134494746 |
| Molecular Formula | C12H9F3N2O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid |
| SMILES | CC1(c2ccc(C(=O)O)c(C(F)(F)F)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H9F3N2O4/c1-11(9(20)16-10(21)17-11)5-2-3-6(8(18)19)7(4-5)12(13,14)15/h2-4H,1H3,(H,18,19)(H2,16,17,20,21) |
| InChIKey | GPXJPIQDKZPAAZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid?
The IUPAC name of 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid (CID 134494746) is 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid?
The canonical SMILES for 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid is CC1(c2ccc(C(=O)O)c(C(F)(F)F)c2)NC(=O)NC1=O.
What is the InChIKey of 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid?
The InChIKey is GPXJPIQDKZPAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3N2O4/c1-11(9(20)16-10(21)17-11)5-2-3-6(8(18)19)7(4-5)12(13,14)15/h2-4H,1H3,(H,18,19)(H2,16,17,20,21).
What are the key properties of 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid?
4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid has a molecular weight of 302.21 g/mol, XLogP of 1.46, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)-2-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 134494746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).