C23H31NO3 — CID 134495466
(4E)-1-(5,6-dimethoxy-1-methylindol-2-yl)-5,9-dimethyldeca-4,8-dien-1-one (PubChem CID 134495466) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (4E)-1-(5,6-dimethoxy-1-methylindol-2-yl)-5,9-dimethyldeca-4,8-dien-1-one.
| Compound Name | (4E)-1-(5,6-dimethoxy-1-methylindol-2-yl)-5,9-dimethyldeca-4,8-dien-1-one |
|---|---|
| PubChem CID | 134495466 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (4E)-1-(5,6-dimethoxy-1-methylindol-2-yl)-5,9-dimethyldeca-4,8-dien-1-one |
| SMILES | COc1cc2cc(C(=O)CC/C=C(\C)CCC=C(C)C)n(C)c2cc1OC |
| InChI | InChI=1S/C23H31NO3/c1-16(2)9-7-10-17(3)11-8-12-21(25)20-13-18-14-22(26-5)23(27-6)15-19(18)24(20)4/h9,11,13-15H,7-8,10,12H2,1-6H3/b17-11+ |
| InChIKey | XYTVWKJLQRMSNP-GZTJUZNOSA-N |
| XLogP | 5.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|