C14H20O3 — CID 134495929
1',1'-dimethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydroindene]-3'a-carbaldehyde (PubChem CID 134495929) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1',1'-dimethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydroindene]-3'a-carbaldehyde.
| Compound Name | 1',1'-dimethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydroindene]-3'a-carbaldehyde |
|---|---|
| PubChem CID | 134495929 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1',1'-dimethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydroindene]-3'a-carbaldehyde |
| SMILES | CC1(C)CCC2(C=O)CCC3(C=C12)OCCO3 |
| InChI | InChI=1S/C14H20O3/c1-12(2)3-4-13(10-15)5-6-14(9-11(12)13)16-7-8-17-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | GJPMFCBXUOOUAY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|