C13H18F6N2O4 — CID 134496688
4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate (PubChem CID 134496688) has the molecular formula C13H18F6N2O4 and a molecular weight of 388.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134496688 |
| Molecular Formula | C13H18F6N2O4 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1,4-dicarboxylate |
| SMILES | [2H]C1([2H])N(C(=O)OC(C(F)(F)F)C(F)(F)F)C([2H])([2H])C([2H])([2H])N(C(=O)OC(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C13H18F6N2O4/c1-11(2,3)25-10(23)21-6-4-20(5-7-21)9(22)24-8(12(14,15)16)13(17,18)19/h8H,4-7H2,1-3H3/i4D2,5D2,6D2,7D2 |
| InChIKey | KFKOIGPCBQDNIR-DUSUNJSHSA-N |
| XLogP | 3.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |