C8H10F6N2O2 — CID 134496707
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate (PubChem CID 134496707) has the molecular formula C8H10F6N2O2 and a molecular weight of 288.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 134496707 |
| Molecular Formula | C8H10F6N2O2 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(C(=O)OC(C(F)(F)F)C(F)(F)F)C1([2H])[2H] |
| InChI | InChI=1S/C8H10F6N2O2/c9-7(10,11)5(8(12,13)14)18-6(17)16-3-1-15-2-4-16/h5,15H,1-4H2/i1D2,2D2,3D2,4D2 |
| InChIKey | LZZVRRMMBYPJSZ-SVYQBANQSA-N |
| XLogP | 1.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |