C11H13FN2O4 — CID 134496870
3-[(5-fluoro-6-methoxy-2-pyridinyl)oxy]pyrrolidine-1-carboxylic acid (PubChem CID 134496870) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 3-[(5-fluoro-6-methoxy-2-pyridinyl)oxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[(5-fluoro-6-methoxy-2-pyridinyl)oxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134496870 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-[(5-fluoro-6-methoxy-2-pyridinyl)oxy]pyrrolidine-1-carboxylic acid |
| SMILES | COc1nc(OC2CCN(C(=O)O)C2)ccc1F |
| InChI | InChI=1S/C11H13FN2O4/c1-17-10-8(12)2-3-9(13-10)18-7-4-5-14(6-7)11(15)16/h2-3,7H,4-6H2,1H3,(H,15,16) |
| InChIKey | BKMVOGHFVJYILN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |