About (4-hydroxy-3-nitrophenyl) 2-methylpentanoate
(4-hydroxy-3-nitrophenyl) 2-methylpentanoate (PubChem CID 134497741) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is (4-hydroxy-3-nitrophenyl) 2-methylpentanoate.
Molecular Properties
| Compound Name | (4-hydroxy-3-nitrophenyl) 2-methylpentanoate |
| PubChem CID | 134497741 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (4-hydroxy-3-nitrophenyl) 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)Oc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15NO5/c1-3-4-8(2)12(15)18-9-5-6-11(14)10(7-9)13(16)17/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | GMEMIVULAIOZKG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-3-nitrophenyl) 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3-nitrophenyl) 2-methylpentanoate?
The IUPAC name of (4-hydroxy-3-nitrophenyl) 2-methylpentanoate (CID 134497741) is (4-hydroxy-3-nitrophenyl) 2-methylpentanoate.
What is the SMILES notation for (4-hydroxy-3-nitrophenyl) 2-methylpentanoate?
The canonical SMILES for (4-hydroxy-3-nitrophenyl) 2-methylpentanoate is CCCC(C)C(=O)Oc1ccc(O)c([N+](=O)[O-])c1.
What is the InChIKey of (4-hydroxy-3-nitrophenyl) 2-methylpentanoate?
The InChIKey is GMEMIVULAIOZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5/c1-3-4-8(2)12(15)18-9-5-6-11(14)10(7-9)13(16)17/h5-8,14H,3-4H2,1-2H3.
What are the key properties of (4-hydroxy-3-nitrophenyl) 2-methylpentanoate?
(4-hydroxy-3-nitrophenyl) 2-methylpentanoate has a molecular weight of 253.25 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3-nitrophenyl) 2-methylpentanoate is sourced from PubChem (CID 134497741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).