About 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline
7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline (PubChem CID 134497776) has the molecular formula C15H9ClN4
and a molecular weight of 280.72 g/mol. Its IUPAC name is 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline.
Molecular Properties
| Compound Name | 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline |
| PubChem CID | 134497776 |
| Molecular Formula | C15H9ClN4 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline |
| SMILES | Clc1cc(-c2cnc3cc[nH]c3c2)c2nccnc2c1 |
| InChI | InChI=1S/C15H9ClN4/c16-10-6-11(15-14(7-10)18-3-4-19-15)9-5-13-12(20-8-9)1-2-17-13/h1-8,17H |
| InChIKey | CRZUDXJIFLZPTC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline?
The IUPAC name of 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline (CID 134497776) is 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline.
What is the SMILES notation for 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline?
The canonical SMILES for 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline is Clc1cc(-c2cnc3cc[nH]c3c2)c2nccnc2c1.
What is the InChIKey of 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline?
The InChIKey is CRZUDXJIFLZPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN4/c16-10-6-11(15-14(7-10)18-3-4-19-15)9-5-13-12(20-8-9)1-2-17-13/h1-8,17H.
What are the key properties of 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline?
7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline has a molecular weight of 280.72 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(1H-pyrrolo[3,2-b]pyridin-6-yl)quinoxaline is sourced from PubChem (CID 134497776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).