About 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride
1-hydrazinyl-N,N-dimethylethanamine;hydrochloride (PubChem CID 134498067) has the molecular formula C4H14ClN3
and a molecular weight of 139.63 g/mol. Its IUPAC name is 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 134498067 |
| Molecular Formula | C4H14ClN3 |
| Molecular Weight | 139.63 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride |
| SMILES | CC(NN)N(C)C.Cl |
| InChI | InChI=1S/C4H13N3.ClH/c1-4(6-5)7(2)3;/h4,6H,5H2,1-3H3;1H |
| InChIKey | VJVXEDNAQQKGOH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.63 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride (CID 134498067) is 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride is CC(NN)N(C)C.Cl.
What is the InChIKey of 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride?
The InChIKey is VJVXEDNAQQKGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N3.ClH/c1-4(6-5)7(2)3;/h4,6H,5H2,1-3H3;1H.
What are the key properties of 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride?
1-hydrazinyl-N,N-dimethylethanamine;hydrochloride has a molecular weight of 139.63 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinyl-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 134498067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).