C23H28O7 — CID 134498382
(2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-2,4-dimethoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 134498382) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-2,4-dimethoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-2,4-dimethoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134498382 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-2,4-dimethoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(OC)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C23H28O7/c1-28-17-10-18(29-2)16(23-22(27)21(26)20(25)19(11-24)30-23)9-15(17)8-12-3-4-13-5-6-14(13)7-12/h3-4,7,9-10,19-27H,5-6,8,11H2,1-2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | LEPCCNITSOTMTI-ZQGJOIPISA-N |
| XLogP | 0.91 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |