About tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate
tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate (PubChem CID 134498612) has the molecular formula C22H26BrNO2
and a molecular weight of 416.36 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| PubChem CID | 134498612 |
| Molecular Formula | C22H26BrNO2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2ccc(Br)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H26BrNO2/c1-21(2,3)26-20(25)24-14-19(16-10-12-18(23)13-11-16)22(4,15-24)17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | AFQFDCLLKUYMPY-SIKLNZKXSA-N |
| XLogP | 5.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate (CID 134498612) is tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](c2ccc(Br)cc2)[C@@](C)(c2ccccc2)C1.
What is the InChIKey of tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate?
The InChIKey is AFQFDCLLKUYMPY-SIKLNZKXSA-N. The full InChI is InChI=1S/C22H26BrNO2/c1-21(2,3)26-20(25)24-14-19(16-10-12-18(23)13-11-16)22(4,15-24)17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3/t19-,22+/m0/s1.
What are the key properties of tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate?
tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate has a molecular weight of 416.36 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4S)-4-(4-bromophenyl)-3-methyl-3-phenylpyrrolidine-1-carboxylate is sourced from PubChem (CID 134498612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).