C28H29F7N2O4 — CID 134498705
1-[4-[(3R,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 134498705) has the molecular formula C28H29F7N2O4 and a molecular weight of 590.54 g/mol. Its IUPAC name is 1-[4-[(3R,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134498705 |
| Molecular Formula | C28H29F7N2O4 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 1-[4-[(3R,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2C[C@@H](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@@](CO)(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C28H29F7N2O4/c1-17(39)36-12-10-19(11-13-36)24(40)37-14-23(25(15-37,16-38)20-6-8-22(29)9-7-20)18-2-4-21(5-3-18)26(41,27(30,31)32)28(33,34)35/h2-9,19,23,38,41H,10-16H2,1H3/t23-,25-/m0/s1 |
| InChIKey | JJNAQMBQZXNSPA-ZCYQVOJMSA-N |
| XLogP | 4.25 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |