C21H21N3O2 — CID 134498820
2-[4-(5-formyl-2,4-dimethylbenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 134498820) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[4-(5-formyl-2,4-dimethylbenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-(5-formyl-2,4-dimethylbenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 134498820 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[4-(5-formyl-2,4-dimethylbenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | Cc1cc(C)c(C(=O)N2CCN(c3ccccc3C#N)CC2)cc1C=O |
| InChI | InChI=1S/C21H21N3O2/c1-15-11-16(2)19(12-18(15)14-25)21(26)24-9-7-23(8-10-24)20-6-4-3-5-17(20)13-22/h3-6,11-12,14H,7-10H2,1-2H3 |
| InChIKey | IETJUBAJARJCBH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|