C23H29NO5 — CID 134499035
(2S,3R,4R,5S,6R)-2-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-(dimethylamino)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 134499035) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-(dimethylamino)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-(dimethylamino)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134499035 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-(dimethylamino)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CN(C)c1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C23H29NO5/c1-24(2)18-8-7-16(23-22(28)21(27)20(26)19(12-25)29-23)11-17(18)10-13-3-4-14-5-6-15(14)9-13/h3-4,7-9,11,19-23,25-28H,5-6,10,12H2,1-2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | REHDOKCGEWYQAR-ZQGJOIPISA-N |
| XLogP | 0.96 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |