C21H17F7O2 — CID 134499172
cis-(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylcyclopentan-1-one (PubChem CID 134499172) has the molecular formula C21H17F7O2 and a molecular weight of 434.35 g/mol. Its IUPAC name is cis-(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylcyclopentan-1-one.
| Compound Name | cis-(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 134499172 |
| Molecular Formula | C21H17F7O2 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | cis-(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylcyclopentan-1-one |
| SMILES | C[C@]1(c2ccc(F)cc2)CC(=O)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F7O2/c1-18(13-6-8-15(22)9-7-13)11-16(29)10-17(18)12-2-4-14(5-3-12)19(30,20(23,24)25)21(26,27)28/h2-9,17,30H,10-11H2,1H3/t17-,18+/m0/s1 |
| InChIKey | SMLFETAQOBRHPY-ZWKOTPCHSA-N |
| XLogP | 5.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |