About (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine
(3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine (PubChem CID 134499174) has the molecular formula C24H24BrN
and a molecular weight of 406.37 g/mol. Its IUPAC name is (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine.
Molecular Properties
| Compound Name | (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine |
| PubChem CID | 134499174 |
| Molecular Formula | C24H24BrN |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine |
| SMILES | Brc1ccc([C@@H]2CN(Cc3ccccc3)C[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24BrN/c25-23-13-11-21(12-14-23)24-18-26(16-20-9-5-2-6-10-20)17-22(24)15-19-7-3-1-4-8-19/h1-14,22,24H,15-18H2/t22-,24+/m1/s1 |
| InChIKey | AEBDCWGNSFVOFE-VWNXMTODSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine?
The IUPAC name of (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine (CID 134499174) is (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine.
What is the SMILES notation for (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine?
The canonical SMILES for (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine is Brc1ccc([C@@H]2CN(Cc3ccccc3)C[C@H]2Cc2ccccc2)cc1.
What is the InChIKey of (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine?
The InChIKey is AEBDCWGNSFVOFE-VWNXMTODSA-N. The full InChI is InChI=1S/C24H24BrN/c25-23-13-11-21(12-14-23)24-18-26(16-20-9-5-2-6-10-20)17-22(24)15-19-7-3-1-4-8-19/h1-14,22,24H,15-18H2/t22-,24+/m1/s1.
What are the key properties of (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine?
(3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine has a molecular weight of 406.37 g/mol, XLogP of 5.91, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1,3-dibenzyl-4-(4-bromophenyl)pyrrolidine is sourced from PubChem (CID 134499174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).