C25H26F7NO3 — CID 134499220
tert-butyl (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 134499220) has the molecular formula C25H26F7NO3 and a molecular weight of 521.47 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134499220 |
| Molecular Formula | C25H26F7NO3 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | tert-butyl (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H26F7NO3/c1-21(2,3)36-20(34)33-13-19(22(4,14-33)16-9-11-18(26)12-10-16)15-5-7-17(8-6-15)23(35,24(27,28)29)25(30,31)32/h5-12,19,35H,13-14H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | NGYTWHUHSJFZCY-SIKLNZKXSA-N |
| XLogP | 6.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |