C27H31FN4O3S — CID 134499676
3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid (PubChem CID 134499676) has the molecular formula C27H31FN4O3S and a molecular weight of 510.64 g/mol. Its IUPAC name is 3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid.
| Compound Name | 3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134499676 |
| Molecular Formula | C27H31FN4O3S |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
| SMILES | CN(C)C(=O)c1ccc(C(CC(=O)O)c2nc(CCCCC3CCc4cccnc4N3)cs2)cc1F |
| InChI | InChI=1S/C27H31FN4O3S/c1-32(2)27(35)21-12-10-18(14-23(21)28)22(15-24(33)34)26-31-20(16-36-26)8-4-3-7-19-11-9-17-6-5-13-29-25(17)30-19/h5-6,10,12-14,16,19,22H,3-4,7-9,11,15H2,1-2H3,(H,29,30)(H,33,34) |
| InChIKey | ISYWRCAYGCAVDF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|