C12H18N6O7S — CID 134500692
[(2R,3S,4R,5R)-5-(4-amino-3-ethoxypyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 134500692) has the molecular formula C12H18N6O7S and a molecular weight of 390.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-3-ethoxypyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-3-ethoxypyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 134500692 |
| Molecular Formula | C12H18N6O7S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-3-ethoxypyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | CCOc1nn([C@@H]2O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H18N6O7S/c1-2-23-11-6-9(13)15-4-16-10(6)18(17-11)12-8(20)7(19)5(25-12)3-24-26(14,21)22/h4-5,7-8,12,19-20H,2-3H2,1H3,(H2,13,15,16)(H2,14,21,22)/t5-,7-,8-,12-/m1/s1 |
| InChIKey | FUGFBXZXIJOVKN-JTFADIMSSA-N |
| XLogP | -2.35 |
| TPSA | 197.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |