C27H32N4O4 — CID 134500698
ethyl (3S)-3-(6-methoxy-3-pyridinyl)-3-[3-methyl-3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoate (PubChem CID 134500698) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is ethyl (3S)-3-(6-methoxy-3-pyridinyl)-3-[3-methyl-3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoate.
| Compound Name | ethyl (3S)-3-(6-methoxy-3-pyridinyl)-3-[3-methyl-3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoate |
|---|---|
| PubChem CID | 134500698 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | ethyl (3S)-3-(6-methoxy-3-pyridinyl)-3-[3-methyl-3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccc(OC)nc1)N1CC(C)(CCCCc2ccc3cccnc3n2)C1=O |
| InChI | InChI=1S/C27H32N4O4/c1-4-35-24(32)16-22(20-11-13-23(34-3)29-17-20)31-18-27(2,26(31)33)14-6-5-9-21-12-10-19-8-7-15-28-25(19)30-21/h7-8,10-13,15,17,22H,4-6,9,14,16,18H2,1-3H3/t22-,27?/m0/s1 |
| InChIKey | UEOPCQHJQQHVHC-YMQLSTQVSA-N |
| XLogP | 4.29 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|