C24H26N4O4 — CID 134500936
3-(6-methoxy-3-pyridinyl)-3-[3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoic acid (PubChem CID 134500936) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-(6-methoxy-3-pyridinyl)-3-[3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoic acid.
| Compound Name | 3-(6-methoxy-3-pyridinyl)-3-[3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 134500936 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-(6-methoxy-3-pyridinyl)-3-[3-[4-(1,8-naphthyridin-2-yl)butyl]-2-oxoazetidin-1-yl]propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)N2CC(CCCCc3ccc4cccnc4n3)C2=O)cn1 |
| InChI | InChI=1S/C24H26N4O4/c1-32-21-11-9-17(14-26-21)20(13-22(29)30)28-15-18(24(28)31)5-2-3-7-19-10-8-16-6-4-12-25-23(16)27-19/h4,6,8-12,14,18,20H,2-3,5,7,13,15H2,1H3,(H,29,30) |
| InChIKey | GCHUZNGBENFCOR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|