C22H22F6N2O2 — CID 134501178
2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]acetamide (PubChem CID 134501178) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]acetamide.
| Compound Name | 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 134501178 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccccc2)CN(CC(N)=O)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N2O2/c1-19(15-5-3-2-4-6-15)13-30(12-18(29)31)11-17(19)14-7-9-16(10-8-14)20(32,21(23,24)25)22(26,27)28/h2-10,17,32H,11-13H2,1H3,(H2,29,31)/t17-,19+/m0/s1 |
| InChIKey | NANKRNOZMVMNLJ-PKOBYXMFSA-N |
| XLogP | 3.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |