About 2-bromo-5,6-dihydroindeno[2,1-b]indole
2-bromo-5,6-dihydroindeno[2,1-b]indole (PubChem CID 134501422) has the molecular formula C15H10BrN
and a molecular weight of 284.16 g/mol. Its IUPAC name is 2-bromo-5,6-dihydroindeno[2,1-b]indole.
Molecular Properties
| Compound Name | 2-bromo-5,6-dihydroindeno[2,1-b]indole |
| PubChem CID | 134501422 |
| Molecular Formula | C15H10BrN |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-bromo-5,6-dihydroindeno[2,1-b]indole |
| SMILES | Brc1ccc2[nH]c3c(c2c1)-c1ccccc1C3 |
| InChI | InChI=1S/C15H10BrN/c16-10-5-6-13-12(8-10)15-11-4-2-1-3-9(11)7-14(15)17-13/h1-6,8,17H,7H2 |
| InChIKey | QUINKXVYXREJDT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-5,6-dihydroindeno[2,1-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,6-dihydroindeno[2,1-b]indole?
The IUPAC name of 2-bromo-5,6-dihydroindeno[2,1-b]indole (CID 134501422) is 2-bromo-5,6-dihydroindeno[2,1-b]indole.
What is the SMILES notation for 2-bromo-5,6-dihydroindeno[2,1-b]indole?
The canonical SMILES for 2-bromo-5,6-dihydroindeno[2,1-b]indole is Brc1ccc2[nH]c3c(c2c1)-c1ccccc1C3.
What is the InChIKey of 2-bromo-5,6-dihydroindeno[2,1-b]indole?
The InChIKey is QUINKXVYXREJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrN/c16-10-5-6-13-12(8-10)15-11-4-2-1-3-9(11)7-14(15)17-13/h1-6,8,17H,7H2.
What are the key properties of 2-bromo-5,6-dihydroindeno[2,1-b]indole?
2-bromo-5,6-dihydroindeno[2,1-b]indole has a molecular weight of 284.16 g/mol, XLogP of 4.50, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6-dihydroindeno[2,1-b]indole is sourced from PubChem (CID 134501422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).