C10H14N6O6S — CID 134501438
[(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 134501438) has the molecular formula C10H14N6O6S and a molecular weight of 346.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 134501438 |
| Molecular Formula | C10H14N6O6S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | Nc1ncnc2c1cnn2[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N6O6S/c11-8-4-1-15-16(9(4)14-3-13-8)10-7(18)6(17)5(22-10)2-21-23(12,19)20/h1,3,5-7,10,17-18H,2H2,(H2,11,13,14)(H2,12,19,20)/t5-,6-,7-,10-/m1/s1 |
| InChIKey | GDGSWPNRFYCUDB-DAGMQNCNSA-N |
| XLogP | -2.75 |
| TPSA | 188.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |