C15H25NO — CID 134501634
(3S,4R,5E)-4-(aminomethyl)-3-propan-2-yl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one (PubChem CID 134501634) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (3S,4R,5E)-4-(aminomethyl)-3-propan-2-yl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one.
| Compound Name | (3S,4R,5E)-4-(aminomethyl)-3-propan-2-yl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one |
|---|---|
| PubChem CID | 134501634 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (3S,4R,5E)-4-(aminomethyl)-3-propan-2-yl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one |
| SMILES | C=C/C=C(\C=C/C)[C@H](CN)[C@@H](C(C)=O)C(C)C |
| InChI | InChI=1S/C15H25NO/c1-6-8-13(9-7-2)14(10-16)15(11(3)4)12(5)17/h6-9,11,14-15H,1,10,16H2,2-5H3/b9-7-,13-8+/t14-,15+/m0/s1 |
| InChIKey | GVHKHDUZSDNAQL-WMBMQTIVSA-N |
| XLogP | 3.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|