C28H24F6N2O2+2 — CID 134502028
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-[1-[(3,5-dimethoxyphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium (PubChem CID 134502028) has the molecular formula C28H24F6N2O2+2 and a molecular weight of 534.50 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-[1-[(3,5-dimethoxyphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-[1-[(3,5-dimethoxyphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 134502028 |
| Molecular Formula | C28H24F6N2O2+2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-[1-[(3,5-dimethoxyphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium |
| SMILES | COc1cc(C[n+]2ccc(-c3cc[n+](Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C28H24F6N2O2/c1-37-25-13-20(14-26(16-25)38-2)18-36-9-5-22(6-10-36)21-3-7-35(8-4-21)17-19-11-23(27(29,30)31)15-24(12-19)28(32,33)34/h3-16H,17-18H2,1-2H3/q+2 |
| InChIKey | UNLKPMYCSHNMGC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|