C15H22N2 — CID 134502375
(Z)-N,N',2-tris(ethenyl)-5,5-dimethyl-4-methylidenehex-2-enimidamide (PubChem CID 134502375) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (Z)-N,N',2-tris(ethenyl)-5,5-dimethyl-4-methylidenehex-2-enimidamide.
| Compound Name | (Z)-N,N',2-tris(ethenyl)-5,5-dimethyl-4-methylidenehex-2-enimidamide |
|---|---|
| PubChem CID | 134502375 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (Z)-N,N',2-tris(ethenyl)-5,5-dimethyl-4-methylidenehex-2-enimidamide |
| SMILES | C=C/N=C(NC=C)/C(C=C)=C\C(=C)C(C)(C)C |
| InChI | InChI=1S/C15H22N2/c1-8-13(11-12(4)15(5,6)7)14(16-9-2)17-10-3/h8-11H,1-4H2,5-7H3,(H,16,17)/b13-11- |
| InChIKey | ZHFLRVGFRMFCOK-QBFSEMIESA-N |
| XLogP | 3.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|