C23H42O — CID 134502376
(2E,4E)-6-tert-butyl-5-ethenyl-8,8-dimethyl-3-(3-methylpentan-3-yloxy)nona-2,4-diene (PubChem CID 134502376) has the molecular formula C23H42O and a molecular weight of 334.59 g/mol. Its IUPAC name is (2E,4E)-6-tert-butyl-5-ethenyl-8,8-dimethyl-3-(3-methylpentan-3-yloxy)nona-2,4-diene.
| Compound Name | (2E,4E)-6-tert-butyl-5-ethenyl-8,8-dimethyl-3-(3-methylpentan-3-yloxy)nona-2,4-diene |
|---|---|
| PubChem CID | 134502376 |
| Molecular Formula | C23H42O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.32 |
| IUPAC Name | (2E,4E)-6-tert-butyl-5-ethenyl-8,8-dimethyl-3-(3-methylpentan-3-yloxy)nona-2,4-diene |
| SMILES | C=C/C(=C\C(=C/C)OC(C)(CC)CC)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H42O/c1-12-18(20(22(8,9)10)17-21(5,6)7)16-19(13-2)24-23(11,14-3)15-4/h12-13,16,20H,1,14-15,17H2,2-11H3/b18-16+,19-13+ |
| InChIKey | GJEDJZJTUXVQQI-OGNJPQJQSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|