C14H18FN3 — CID 134502427
5-ethyl-N-[(3Z,5E)-6-fluoro-2-methylidenehepta-3,5-dienyl]pyrimidin-2-amine (PubChem CID 134502427) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-ethyl-N-[(3Z,5E)-6-fluoro-2-methylidenehepta-3,5-dienyl]pyrimidin-2-amine.
| Compound Name | 5-ethyl-N-[(3Z,5E)-6-fluoro-2-methylidenehepta-3,5-dienyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134502427 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 5-ethyl-N-[(3Z,5E)-6-fluoro-2-methylidenehepta-3,5-dienyl]pyrimidin-2-amine |
| SMILES | C=C(/C=C\C=C(/C)F)CNc1ncc(CC)cn1 |
| InChI | InChI=1S/C14H18FN3/c1-4-13-9-17-14(18-10-13)16-8-11(2)6-5-7-12(3)15/h5-7,9-10H,2,4,8H2,1,3H3,(H,16,17,18)/b6-5-,12-7+ |
| InChIKey | TXBSAOJIQAVGNU-UNKATYBDSA-N |
| XLogP | 3.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|