C13H18N2O — CID 134502576
N-[(1E,3Z,6Z,8Z)-2-amino-6-ethenyldeca-1,3,6,8-tetraenyl]formamide (PubChem CID 134502576) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[(1E,3Z,6Z,8Z)-2-amino-6-ethenyldeca-1,3,6,8-tetraenyl]formamide.
| Compound Name | N-[(1E,3Z,6Z,8Z)-2-amino-6-ethenyldeca-1,3,6,8-tetraenyl]formamide |
|---|---|
| PubChem CID | 134502576 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[(1E,3Z,6Z,8Z)-2-amino-6-ethenyldeca-1,3,6,8-tetraenyl]formamide |
| SMILES | C=C/C(=C\C=C/C)C/C=C\C(N)=C/NC=O |
| InChI | InChI=1S/C13H18N2O/c1-3-5-7-12(4-2)8-6-9-13(14)10-15-11-16/h3-7,9-11H,2,8,14H2,1H3,(H,15,16)/b5-3-,9-6-,12-7+,13-10+ |
| InChIKey | VTCHOTKVFWKBBB-WSYOEFEISA-N |
| XLogP | 2.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|