C7H7N4OPS — CID 134502811
5-amino-N-phosphanylthieno[2,3-c]pyridazine-6-carboxamide (PubChem CID 134502811) has the molecular formula C7H7N4OPS and a molecular weight of 226.20 g/mol. Its IUPAC name is 5-amino-N-phosphanylthieno[2,3-c]pyridazine-6-carboxamide.
| Compound Name | 5-amino-N-phosphanylthieno[2,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 134502811 |
| Molecular Formula | C7H7N4OPS |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 5-amino-N-phosphanylthieno[2,3-c]pyridazine-6-carboxamide |
| SMILES | Nc1c(C(=O)NP)sc2nnccc12 |
| InChI | InChI=1S/C7H7N4OPS/c8-4-3-1-2-9-10-7(3)14-5(4)6(12)11-13/h1-2H,8,13H2,(H,11,12) |
| InChIKey | JKEOBZANVVQESJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|