About 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine
6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine (PubChem CID 134502848) has the molecular formula C10H11N3S
and a molecular weight of 205.29 g/mol. Its IUPAC name is 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine.
Molecular Properties
| Compound Name | 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine |
| PubChem CID | 134502848 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine |
| SMILES | C=Cc1sc2nnc(C)c(C)c2c1N |
| InChI | InChI=1S/C10H11N3S/c1-4-7-9(11)8-5(2)6(3)12-13-10(8)14-7/h4H,1,11H2,2-3H3 |
| InChIKey | CNAWMUHRGSTWHV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine?
The IUPAC name of 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine (CID 134502848) is 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine.
What is the SMILES notation for 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine?
The canonical SMILES for 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine is C=Cc1sc2nnc(C)c(C)c2c1N.
What is the InChIKey of 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine?
The InChIKey is CNAWMUHRGSTWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S/c1-4-7-9(11)8-5(2)6(3)12-13-10(8)14-7/h4H,1,11H2,2-3H3.
What are the key properties of 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine?
6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine has a molecular weight of 205.29 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-3,4-dimethylthieno[2,3-c]pyridazin-5-amine is sourced from PubChem (CID 134502848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).