C21H20FN5OS — CID 134502887
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2-fluoro-3-pyridinyl)phenyl]methylamino]methanol (PubChem CID 134502887) has the molecular formula C21H20FN5OS and a molecular weight of 409.49 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2-fluoro-3-pyridinyl)phenyl]methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2-fluoro-3-pyridinyl)phenyl]methylamino]methanol |
|---|---|
| PubChem CID | 134502887 |
| Molecular Formula | C21H20FN5OS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2-fluoro-3-pyridinyl)phenyl]methylamino]methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3ccc(-c4cccnc4F)cc3)c(N)c2c1C |
| InChI | InChI=1S/C21H20FN5OS/c1-11-12(2)26-27-21-16(11)17(23)18(29-21)20(28)25-10-13-5-7-14(8-6-13)15-4-3-9-24-19(15)22/h3-9,20,25,28H,10,23H2,1-2H3 |
| InChIKey | PAJPCRHAJNFXEW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|