C22H33N3O2 — CID 134503014
(5E)-3-cyclopentyl-2-cyclopentylimino-5-[(Z,2E)-5-(ethylamino)-2-ethylidenepent-3-enylidene]-1,3-oxazolidin-4-one (PubChem CID 134503014) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (5E)-3-cyclopentyl-2-cyclopentylimino-5-[(Z,2E)-5-(ethylamino)-2-ethylidenepent-3-enylidene]-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-cyclopentyl-2-cyclopentylimino-5-[(Z,2E)-5-(ethylamino)-2-ethylidenepent-3-enylidene]-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 134503014 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (5E)-3-cyclopentyl-2-cyclopentylimino-5-[(Z,2E)-5-(ethylamino)-2-ethylidenepent-3-enylidene]-1,3-oxazolidin-4-one |
| SMILES | C/C=C(\C=C/CNCC)/C=C1/O/C(=N\C2CCCC2)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C22H33N3O2/c1-3-17(10-9-15-23-4-2)16-20-21(26)25(19-13-7-8-14-19)22(27-20)24-18-11-5-6-12-18/h3,9-10,16,18-19,23H,4-8,11-15H2,1-2H3/b10-9-,17-3+,20-16+,24-22- |
| InChIKey | CFMNAVQHZBUJIX-JXZSEENESA-N |
| XLogP | 4.08 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|