C21H18F2N4O2 — CID 134503118
[3-[(5-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone (PubChem CID 134503118) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is [3-[(5-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone.
| Compound Name | [3-[(5-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 134503118 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [3-[(5-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone |
| SMILES | O=C(c1cccc(F)c1-c1ncccn1)N1CCCC(Oc2ccc(F)cn2)C1 |
| InChI | InChI=1S/C21H18F2N4O2/c22-14-7-8-18(26-12-14)29-15-4-2-11-27(13-15)21(28)16-5-1-6-17(23)19(16)20-24-9-3-10-25-20/h1,3,5-10,12,15H,2,4,11,13H2 |
| InChIKey | GULBHXXAKZDGPN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |