C18H29N5 — CID 134503125
1-[2-[2-imidazol-1-ylethyl(methyl)amino]ethyl]-2,3,4,6,7,8-hexahydrocyclohepta[b]pyridin-8-amine (PubChem CID 134503125) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is 1-[2-[2-imidazol-1-ylethyl(methyl)amino]ethyl]-2,3,4,6,7,8-hexahydrocyclohepta[b]pyridin-8-amine.
| Compound Name | 1-[2-[2-imidazol-1-ylethyl(methyl)amino]ethyl]-2,3,4,6,7,8-hexahydrocyclohepta[b]pyridin-8-amine |
|---|---|
| PubChem CID | 134503125 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-[2-[2-imidazol-1-ylethyl(methyl)amino]ethyl]-2,3,4,6,7,8-hexahydrocyclohepta[b]pyridin-8-amine |
| SMILES | CN(CCN1CCCC2=CCCC(N)C=C21)CCn1ccnc1 |
| InChI | InChI=1S/C18H29N5/c1-21(10-12-22-9-7-20-15-22)11-13-23-8-3-5-16-4-2-6-17(19)14-18(16)23/h4,7,9,14-15,17H,2-3,5-6,8,10-13,19H2,1H3 |
| InChIKey | BGFCLWVUFUYBIL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |