C19H42N2O2 — CID 134503579
N'-(1,1-dihexoxyethyl)pentane-1,5-diamine (PubChem CID 134503579) has the molecular formula C19H42N2O2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N'-(1,1-dihexoxyethyl)pentane-1,5-diamine.
| Compound Name | N'-(1,1-dihexoxyethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 134503579 |
| Molecular Formula | C19H42N2O2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.32 |
| IUPAC Name | N'-(1,1-dihexoxyethyl)pentane-1,5-diamine |
| SMILES | CCCCCCOC(C)(NCCCCCN)OCCCCCC |
| InChI | InChI=1S/C19H42N2O2/c1-4-6-8-13-17-22-19(3,21-16-12-10-11-15-20)23-18-14-9-7-5-2/h21H,4-18,20H2,1-3H3 |
| InChIKey | PBLBJESVFFJKQC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|