C19H23ClN2O — CID 134504084
(2E)-N-[(1E,3E,5Z)-5-[1-(but-3-enylideneamino)ethenyl]-4-chlorohepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide (PubChem CID 134504084) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is (2E)-N-[(1E,3E,5Z)-5-[1-(but-3-enylideneamino)ethenyl]-4-chlorohepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide.
| Compound Name | (2E)-N-[(1E,3E,5Z)-5-[1-(but-3-enylideneamino)ethenyl]-4-chlorohepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 134504084 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2E)-N-[(1E,3E,5Z)-5-[1-(but-3-enylideneamino)ethenyl]-4-chlorohepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C)C(=O)N/C=C/C=C(/Cl)C(=CC)C(=C)/N=C/CC=C |
| InChI | InChI=1S/C19H23ClN2O/c1-6-9-13-21-16(5)17(8-3)18(20)12-10-14-22-19(23)15(4)11-7-2/h6-8,10-14H,1-2,5,9H2,3-4H3,(H,22,23)/b14-10+,15-11+,17-8-,18-12+,21-13+ |
| InChIKey | LBGJAVYDGHPJFN-YKDOYDNMSA-N |
| XLogP | 4.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|