C19H17BrN2O3S — CID 134504236
4-[(8-bromo-2-oxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-5-yl)methyl]-N-hydroxybenzamide (PubChem CID 134504236) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is 4-[(8-bromo-2-oxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-5-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(8-bromo-2-oxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-5-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134504236 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 4-[(8-bromo-2-oxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-5-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2c3c(c4cc(Br)ccc42)CS(=O)CC3)cc1 |
| InChI | InChI=1S/C19H17BrN2O3S/c20-14-5-6-17-15(9-14)16-11-26(25)8-7-18(16)22(17)10-12-1-3-13(4-2-12)19(23)21-24/h1-6,9,24H,7-8,10-11H2,(H,21,23) |
| InChIKey | PIUPVMKDFRYFCN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|