C37H44N2O — CID 134504318
4-ethenyl-1-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-6,7-dimethyl-8-methylideneazocan-2-one (PubChem CID 134504318) has the molecular formula C37H44N2O and a molecular weight of 532.77 g/mol. Its IUPAC name is 4-ethenyl-1-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-6,7-dimethyl-8-methylideneazocan-2-one.
| Compound Name | 4-ethenyl-1-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-6,7-dimethyl-8-methylideneazocan-2-one |
|---|---|
| PubChem CID | 134504318 |
| Molecular Formula | C37H44N2O |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | 4-ethenyl-1-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-6,7-dimethyl-8-methylideneazocan-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc(Cc3ccc(N4C(=C)C5C(C)CC(C=C)C5C4=C)cc3)cc2)C(=C)C(C)C(C)C1 |
| InChI | InChI=1S/C37H44N2O/c1-9-29-19-23(3)25(5)26(6)39(35(40)22-29)34-17-13-31(14-18-34)21-30-11-15-33(16-12-30)38-27(7)36-24(4)20-32(10-2)37(36)28(38)8/h9-18,23-25,29,32,36-37H,1-2,6-8,19-22H2,3-5H3 |
| InChIKey | JWNGDCJTJCUCNA-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|