C9H8F6 — CID 134504364
(3E,5Z)-8,8,8-trifluoro-3-(trifluoromethyl)octa-1,3,5-triene (PubChem CID 134504364) has the molecular formula C9H8F6 and a molecular weight of 230.15 g/mol. Its IUPAC name is (3E,5Z)-8,8,8-trifluoro-3-(trifluoromethyl)octa-1,3,5-triene.
| Compound Name | (3E,5Z)-8,8,8-trifluoro-3-(trifluoromethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 134504364 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (3E,5Z)-8,8,8-trifluoro-3-(trifluoromethyl)octa-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6/c1-2-7(9(13,14)15)5-3-4-6-8(10,11)12/h2-5H,1,6H2/b4-3-,7-5+ |
| InChIKey | LOEQUWGSMWPECI-QVXLNCAUSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|