About 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran
2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran (PubChem CID 134504475) has the molecular formula C13H11BrO
and a molecular weight of 263.13 g/mol. Its IUPAC name is 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran.
Molecular Properties
| Compound Name | 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran |
| PubChem CID | 134504475 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran |
| SMILES | Brc1ccc2oc3c(c2c1)CCCC=C3 |
| InChI | InChI=1S/C13H11BrO/c14-9-6-7-13-11(8-9)10-4-2-1-3-5-12(10)15-13/h3,5-8H,1-2,4H2 |
| InChIKey | NVTZGPVHURJHEG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran?
The IUPAC name of 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran (CID 134504475) is 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran.
What is the SMILES notation for 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran?
The canonical SMILES for 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran is Brc1ccc2oc3c(c2c1)CCCC=C3.
What is the InChIKey of 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran?
The InChIKey is NVTZGPVHURJHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO/c14-9-6-7-13-11(8-9)10-4-2-1-3-5-12(10)15-13/h3,5-8H,1-2,4H2.
What are the key properties of 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran?
2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran has a molecular weight of 263.13 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9,10-dihydro-8H-cyclohepta[b][1]benzofuran is sourced from PubChem (CID 134504475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).