About (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine
(2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine (PubChem CID 134504837) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine.
Molecular Properties
| Compound Name | (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine |
| PubChem CID | 134504837 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine |
| SMILES | C=CC(=C)N(CC)[C@@H](C)C(=C)OCC |
| InChI | InChI=1S/C12H21NO/c1-7-10(4)13(8-2)11(5)12(6)14-9-3/h7,11H,1,4,6,8-9H2,2-3,5H3/t11-/m0/s1 |
| InChIKey | LCGRLCHDJFEMLF-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine?
The IUPAC name of (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine (CID 134504837) is (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine.
What is the SMILES notation for (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine?
The canonical SMILES for (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine is C=CC(=C)N(CC)[C@@H](C)C(=C)OCC.
What is the InChIKey of (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine?
The InChIKey is LCGRLCHDJFEMLF-NSHDSACASA-N. The full InChI is InChI=1S/C12H21NO/c1-7-10(4)13(8-2)11(5)12(6)14-9-3/h7,11H,1,4,6,8-9H2,2-3,5H3/t11-/m0/s1.
What are the key properties of (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine?
(2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine has a molecular weight of 195.31 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-buta-1,3-dien-2-yl-3-ethoxy-N-ethylbut-3-en-2-amine is sourced from PubChem (CID 134504837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).