C18H12F6S3 — CID 134505102
3-(2,2,3,3,4,4-hexafluoro-5-methylcyclopentyl)-2,5-dithiophen-2-ylthiophene (PubChem CID 134505102) has the molecular formula C18H12F6S3 and a molecular weight of 438.48 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4-hexafluoro-5-methylcyclopentyl)-2,5-dithiophen-2-ylthiophene.
| Compound Name | 3-(2,2,3,3,4,4-hexafluoro-5-methylcyclopentyl)-2,5-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 134505102 |
| Molecular Formula | C18H12F6S3 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 3-(2,2,3,3,4,4-hexafluoro-5-methylcyclopentyl)-2,5-dithiophen-2-ylthiophene |
| SMILES | CC1C(c2cc(-c3cccs3)sc2-c2cccs2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H12F6S3/c1-9-14(17(21,22)18(23,24)16(9,19)20)10-8-13(11-4-2-6-25-11)27-15(10)12-5-3-7-26-12/h2-9,14H,1H3 |
| InChIKey | RSNCQEOSVGVMGJ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|