C8H16N6 — CID 134505108
(2E,4E)-2,4-bis(methylidenehydrazinylidene)hexane-1,3-diamine (PubChem CID 134505108) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is (2E,4E)-2,4-bis(methylidenehydrazinylidene)hexane-1,3-diamine.
| Compound Name | (2E,4E)-2,4-bis(methylidenehydrazinylidene)hexane-1,3-diamine |
|---|---|
| PubChem CID | 134505108 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (2E,4E)-2,4-bis(methylidenehydrazinylidene)hexane-1,3-diamine |
| SMILES | C=N/N=C(\CC)C(N)/C(CN)=N/N=C |
| InChI | InChI=1S/C8H16N6/c1-4-6(13-11-2)8(10)7(5-9)14-12-3/h8H,2-5,9-10H2,1H3/b13-6+,14-7+ |
| InChIKey | SOMDEFPLEIBMIG-AANLELRNSA-N |
| XLogP | -0.20 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|